C26H29N3O5 — CID 22521786
10-(1,3-benzodioxol-5-ylmethyl)-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 22521786) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-ylmethyl)-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | 10-(1,3-benzodioxol-5-ylmethyl)-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 22521786 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 10-(1,3-benzodioxol-5-ylmethyl)-11-methyl-N-(2-methylcyclohexyl)-9-oxo-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CC1CCCCC1NC(=O)C1(C)Cn2c(cc3occc32)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H29N3O5/c1-16-5-3-4-6-18(16)27-25(31)26(2)14-28-19-9-10-32-22(19)12-20(28)24(30)29(26)13-17-7-8-21-23(11-17)34-15-33-21/h7-12,16,18H,3-6,13-15H2,1-2H3,(H,27,31) |
| InChIKey | NWKYQMSGKAVHDE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |