C25H42N4O3 — CID 22522296
2-tert-butyl-N-cyclooctyl-5-(3-ethoxypropyl)-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide (PubChem CID 22522296) has the molecular formula C25H42N4O3 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-tert-butyl-N-cyclooctyl-5-(3-ethoxypropyl)-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide.
| Compound Name | 2-tert-butyl-N-cyclooctyl-5-(3-ethoxypropyl)-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 22522296 |
| Molecular Formula | C25H42N4O3 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | 2-tert-butyl-N-cyclooctyl-5-(3-ethoxypropyl)-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-6-carboxamide |
| SMILES | CCOCCCN1C(=O)c2cc(C(C)(C)C)nn2CC1(C)C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C25H42N4O3/c1-6-32-16-12-15-28-22(30)20-17-21(24(2,3)4)27-29(20)18-25(28,5)23(31)26-19-13-10-8-7-9-11-14-19/h17,19H,6-16,18H2,1-5H3,(H,26,31) |
| InChIKey | WJYOPEOAGAPUKE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|