C19H26N2O6 — CID 2252340
2-methoxyethyl (4R,5S)-4-(3-methoxy-4-propoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 2252340) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-methoxyethyl (4R,5S)-4-(3-methoxy-4-propoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | 2-methoxyethyl (4R,5S)-4-(3-methoxy-4-propoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2252340 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-methoxyethyl (4R,5S)-4-(3-methoxy-4-propoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | C=C1NC(=O)NC(c2ccc(OCCC)c(OC)c2)[C@@H]1C(=O)OCCOC |
| InChI | InChI=1S/C19H26N2O6/c1-5-8-26-14-7-6-13(11-15(14)25-4)17-16(12(2)20-19(23)21-17)18(22)27-10-9-24-3/h6-7,11,16-17H,2,5,8-10H2,1,3-4H3,(H2,20,21,23)/t16-,17?/m1/s1 |
| InChIKey | HTLZFDZPBLFEMX-TZHYSIJRSA-N |
| XLogP | 2.16 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|