About [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone
[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone (PubChem CID 22523743) has the molecular formula C20H16FN3O2S
and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone |
| PubChem CID | 22523743 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc2c(c1)sc1nc(-c3ccc(F)cc3)cn12)N1CCOCC1 |
| InChI | InChI=1S/C20H16FN3O2S/c21-15-4-1-13(2-5-15)16-12-24-17-6-3-14(11-18(17)27-20(24)22-16)19(25)23-7-9-26-10-8-23/h1-6,11-12H,7-10H2 |
| InChIKey | XWVCUDKRHYMFBX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone?
The IUPAC name of [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone (CID 22523743) is [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone is O=C(c1ccc2c(c1)sc1nc(-c3ccc(F)cc3)cn12)N1CCOCC1.
What is the InChIKey of [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone?
The InChIKey is XWVCUDKRHYMFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN3O2S/c21-15-4-1-13(2-5-15)16-12-24-17-6-3-14(11-18(17)27-20(24)22-16)19(25)23-7-9-26-10-8-23/h1-6,11-12H,7-10H2.
What are the key properties of [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone?
[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone has a molecular weight of 381.43 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 22523743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).