C27H32O9 — CID 22524987
(1R,3R,8R,12E,18Z,20Z,24R,25S,26S)-13-(hydroxymethyl)-5,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,17,22-trione (PubChem CID 22524987) has the molecular formula C27H32O9 and a molecular weight of 500.54 g/mol. Its IUPAC name is (1R,3R,8R,12E,18Z,20Z,24R,25S,26S)-13-(hydroxymethyl)-5,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,17,22-trione.
| Compound Name | (1R,3R,8R,12E,18Z,20Z,24R,25S,26S)-13-(hydroxymethyl)-5,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,17,22-trione |
|---|---|
| PubChem CID | 22524987 |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (1R,3R,8R,12E,18Z,20Z,24R,25S,26S)-13-(hydroxymethyl)-5,25-dimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,17,22-trione |
| SMILES | CC1=C[C@H]2O[C@@H]3C[C@H]4OC(=O)/C=C\C=C/C(=O)OCC/C(CO)=C\C(=O)OC[C@@]2(CC1)[C@]4(C)[C@]31CO1 |
| InChI | InChI=1S/C27H32O9/c1-17-7-9-26-15-33-24(31)12-18(14-28)8-10-32-22(29)5-3-4-6-23(30)36-19-13-21(35-20(26)11-17)27(16-34-27)25(19,26)2/h3-6,11-12,19-21,28H,7-10,13-16H2,1-2H3/b5-3-,6-4-,18-12+/t19-,20-,21-,25-,26-,27+/m1/s1 |
| InChIKey | OQVXFAVSMVQTMH-CVUHZTBISA-N |
| XLogP | 2.09 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|