C15H14INO3 — CID 22525375
(1S,3S,6S,7R,9S)-N-(4-iodophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide (PubChem CID 22525375) has the molecular formula C15H14INO3 and a molecular weight of 383.19 g/mol. Its IUPAC name is (1S,3S,6S,7R,9S)-N-(4-iodophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide.
| Compound Name | (1S,3S,6S,7R,9S)-N-(4-iodophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
|---|---|
| PubChem CID | 22525375 |
| Molecular Formula | C15H14INO3 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | (1S,3S,6S,7R,9S)-N-(4-iodophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)[C@H]1[C@H]2C[C@@H]3[C@@H]1C(=O)O[C@H]3C2 |
| InChI | InChI=1S/C15H14INO3/c16-8-1-3-9(4-2-8)17-14(18)12-7-5-10-11(6-7)20-15(19)13(10)12/h1-4,7,10-13H,5-6H2,(H,17,18)/t7-,10-,11-,12-,13-/m0/s1 |
| InChIKey | AGIHJRKHMINQHJ-CYYHPJSISA-N |
| XLogP | 2.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|