C20H21N3O2 — CID 22525555
(1S,2R,6S,7R,8S,10R)-4-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 22525555) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S,10R)-4-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S,10R)-4-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 22525555 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (1S,2R,6S,7R,8S,10R)-4-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | CN(C)c1ccc(/C=N\N2C(=O)[C@@H]3[C@H]4C=C[C@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-22(2)12-5-3-11(4-6-12)10-21-23-19(24)17-13-7-8-14(16-9-15(13)16)18(17)20(23)25/h3-8,10,13-18H,9H2,1-2H3/b21-10-/t13-,14+,15-,16+,17+,18- |
| InChIKey | CYIRFOHUIPKUIU-JBXBNDGOSA-N |
| XLogP | 2.14 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|