C18H15BrN4O3 — CID 22525695
6-(4-bromophenoxy)-N-(2,4-dimethylphenyl)-5-nitropyrimidin-4-amine (PubChem CID 22525695) has the molecular formula C18H15BrN4O3 and a molecular weight of 415.25 g/mol. Its IUPAC name is 6-(4-bromophenoxy)-N-(2,4-dimethylphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-bromophenoxy)-N-(2,4-dimethylphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22525695 |
| Molecular Formula | C18H15BrN4O3 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 6-(4-bromophenoxy)-N-(2,4-dimethylphenyl)-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2ncnc(Oc3ccc(Br)cc3)c2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C18H15BrN4O3/c1-11-3-8-15(12(2)9-11)22-17-16(23(24)25)18(21-10-20-17)26-14-6-4-13(19)5-7-14/h3-10H,1-2H3,(H,20,21,22) |
| InChIKey | NJAXZMVYXGNISC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|