C28H24N3O2S2+ — CID 2252692
2-(benzenesulfonylmethyl)-3-(4-methylphenyl)-N,N-diphenyl-1,2,4-thiadiazol-2-ium-5-amine (PubChem CID 2252692) has the molecular formula C28H24N3O2S2+ and a molecular weight of 498.65 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-3-(4-methylphenyl)-N,N-diphenyl-1,2,4-thiadiazol-2-ium-5-amine.
| Compound Name | 2-(benzenesulfonylmethyl)-3-(4-methylphenyl)-N,N-diphenyl-1,2,4-thiadiazol-2-ium-5-amine |
|---|---|
| PubChem CID | 2252692 |
| Molecular Formula | C28H24N3O2S2+ |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-3-(4-methylphenyl)-N,N-diphenyl-1,2,4-thiadiazol-2-ium-5-amine |
| SMILES | Cc1ccc(-c2nc(N(c3ccccc3)c3ccccc3)s[n+]2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N3O2S2/c1-22-17-19-23(20-18-22)27-29-28(34-30(27)21-35(32,33)26-15-9-4-10-16-26)31(24-11-5-2-6-12-24)25-13-7-3-8-14-25/h2-20H,21H2,1H3/q+1 |
| InChIKey | IHQOMNGPQQHEDJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|