C20H24N4O3S2 — CID 22529422
(5E)-5-[[2-(3-ethoxypropylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 22529422) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (5E)-5-[[2-(3-ethoxypropylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(3-ethoxypropylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 22529422 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (5E)-5-[[2-(3-ethoxypropylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOCCCNc1nc2ccc(C)cn2c(=O)c1/C=C1/SC(=S)N(CC)C1=O |
| InChI | InChI=1S/C20H24N4O3S2/c1-4-23-19(26)15(29-20(23)28)11-14-17(21-9-6-10-27-5-2)22-16-8-7-13(3)12-24(16)18(14)25/h7-8,11-12,21H,4-6,9-10H2,1-3H3/b15-11+ |
| InChIKey | OWVUQNONBQPUGI-RVDMUPIBSA-N |
| XLogP | 3.06 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|