C24H32N4O2S2 — CID 22529618
(5E)-3-(2-ethylhexyl)-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 22529618) has the molecular formula C24H32N4O2S2 and a molecular weight of 472.68 g/mol. Its IUPAC name is (5E)-3-(2-ethylhexyl)-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-ethylhexyl)-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 22529618 |
| Molecular Formula | C24H32N4O2S2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (5E)-3-(2-ethylhexyl)-5-[[9-methyl-4-oxo-2-(propylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C\c2c(NCCC)nc3c(C)cccn3c2=O)SC1=S |
| InChI | InChI=1S/C24H32N4O2S2/c1-5-8-11-17(7-3)15-28-23(30)19(32-24(28)31)14-18-20(25-12-6-2)26-21-16(4)10-9-13-27(21)22(18)29/h9-10,13-14,17,25H,5-8,11-12,15H2,1-4H3/b19-14+ |
| InChIKey | UQEJPDXIQFTTMX-XMHGGMMESA-N |
| XLogP | 5.24 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|