C28H24N4O2S2 — CID 22529727
(5E)-3-benzyl-5-[[9-methyl-4-oxo-2-(2-phenylethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 22529727) has the molecular formula C28H24N4O2S2 and a molecular weight of 512.66 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[9-methyl-4-oxo-2-(2-phenylethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[[9-methyl-4-oxo-2-(2-phenylethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 22529727 |
| Molecular Formula | C28H24N4O2S2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (5E)-3-benzyl-5-[[9-methyl-4-oxo-2-(2-phenylethylamino)pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccn2c(=O)c(/C=C3/SC(=S)N(Cc4ccccc4)C3=O)c(NCCc3ccccc3)nc12 |
| InChI | InChI=1S/C28H24N4O2S2/c1-19-9-8-16-31-25(19)30-24(29-15-14-20-10-4-2-5-11-20)22(26(31)33)17-23-27(34)32(28(35)36-23)18-21-12-6-3-7-13-21/h2-13,16-17,29H,14-15,18H2,1H3/b23-17+ |
| InChIKey | WAWJJMZTSBDGRO-HAVVHWLPSA-N |
| XLogP | 5.06 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|