About 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine
4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22531169) has the molecular formula C15H10ClFN6O2
and a molecular weight of 360.74 g/mol. Its IUPAC name is 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine |
| PubChem CID | 22531169 |
| Molecular Formula | C15H10ClFN6O2 |
| Molecular Weight | 360.74 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(F)cc2)ncnc1Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H10ClFN6O2/c16-9-1-6-12(18-7-9)22-15-13(23(24)25)14(19-8-20-15)21-11-4-2-10(17)3-5-11/h1-8H,(H2,18,19,20,21,22) |
| InChIKey | TXORTOFVBNVDNT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.74 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine?
The IUPAC name of 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine (CID 22531169) is 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine.
What is the SMILES notation for 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine?
The canonical SMILES for 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine is O=[N+]([O-])c1c(Nc2ccc(F)cc2)ncnc1Nc1ccc(Cl)cn1.
What is the InChIKey of 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine?
The InChIKey is TXORTOFVBNVDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClFN6O2/c16-9-1-6-12(18-7-9)22-15-13(23(24)25)14(19-8-20-15)21-11-4-2-10(17)3-5-11/h1-8H,(H2,18,19,20,21,22).
What are the key properties of 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine?
4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine has a molecular weight of 360.74 g/mol, XLogP of 4.06, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(5-chloro-2-pyridinyl)-6-N-(4-fluorophenyl)-5-nitropyrimidine-4,6-diamine is sourced from PubChem (CID 22531169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).