About 1-propan-2-ylnaphthalene
1-propan-2-ylnaphthalene (PubChem CID 22535) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-propan-2-ylnaphthalene.
Molecular Properties
| Compound Name | 1-propan-2-ylnaphthalene |
| PubChem CID | 22535 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-propan-2-ylnaphthalene |
| SMILES | CC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H14/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12/h3-10H,1-2H3 |
| InChIKey | PMPBFICDXLLSRM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-propan-2-ylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylnaphthalene?
The IUPAC name of 1-propan-2-ylnaphthalene (CID 22535) is 1-propan-2-ylnaphthalene.
What is the SMILES notation for 1-propan-2-ylnaphthalene?
The canonical SMILES for 1-propan-2-ylnaphthalene is CC(C)c1cccc2ccccc12.
What is the InChIKey of 1-propan-2-ylnaphthalene?
The InChIKey is PMPBFICDXLLSRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12/h3-10H,1-2H3.
What are the key properties of 1-propan-2-ylnaphthalene?
1-propan-2-ylnaphthalene has a molecular weight of 170.25 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylnaphthalene is sourced from PubChem (CID 22535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).