About 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one
4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one (PubChem CID 22537514) has the molecular formula C12H11N3O4
and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one |
| PubChem CID | 22537514 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Oc2nc[nH]c(=O)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C12H11N3O4/c1-7-3-4-9(5-8(7)2)19-12-10(15(17)18)11(16)13-6-14-12/h3-6H,1-2H3,(H,13,14,16) |
| InChIKey | VVOJXYQFEOAKMZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one?
The IUPAC name of 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one (CID 22537514) is 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one.
What is the SMILES notation for 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one?
The canonical SMILES for 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one is Cc1ccc(Oc2nc[nH]c(=O)c2[N+](=O)[O-])cc1C.
What is the InChIKey of 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one?
The InChIKey is VVOJXYQFEOAKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O4/c1-7-3-4-9(5-8(7)2)19-12-10(15(17)18)11(16)13-6-14-12/h3-6H,1-2H3,(H,13,14,16).
What are the key properties of 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one?
4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one has a molecular weight of 261.24 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylphenoxy)-5-nitro-1H-pyrimidin-6-one is sourced from PubChem (CID 22537514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).