C25H26N6 — CID 22539339
6-(2,2-diphenylhydrazinyl)-4-N-ethyl-4-N-(3-methylphenyl)pyrimidine-4,5-diamine (PubChem CID 22539339) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 6-(2,2-diphenylhydrazinyl)-4-N-ethyl-4-N-(3-methylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(2,2-diphenylhydrazinyl)-4-N-ethyl-4-N-(3-methylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22539339 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 6-(2,2-diphenylhydrazinyl)-4-N-ethyl-4-N-(3-methylphenyl)pyrimidine-4,5-diamine |
| SMILES | CCN(c1cccc(C)c1)c1ncnc(NN(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C25H26N6/c1-3-30(22-16-10-11-19(2)17-22)25-23(26)24(27-18-28-25)29-31(20-12-6-4-7-13-20)21-14-8-5-9-15-21/h4-18H,3,26H2,1-2H3,(H,27,28,29) |
| InChIKey | DOEFIKOJVPGLRJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|