C20H23N5 — CID 22539701
4-N,6-N-diethyl-4-N,6-N-diphenylpyrimidine-4,5,6-triamine (PubChem CID 22539701) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-N,6-N-diethyl-4-N,6-N-diphenylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N-diethyl-4-N,6-N-diphenylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22539701 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 4-N,6-N-diethyl-4-N,6-N-diphenylpyrimidine-4,5,6-triamine |
| SMILES | CCN(c1ccccc1)c1ncnc(N(CC)c2ccccc2)c1N |
| InChI | InChI=1S/C20H23N5/c1-3-24(16-11-7-5-8-12-16)19-18(21)20(23-15-22-19)25(4-2)17-13-9-6-10-14-17/h5-15H,3-4,21H2,1-2H3 |
| InChIKey | RXLKDQYVFGCDKW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |