C27H31ClNO5+ — CID 2254069
(1R)-1-(3-chlorophenyl)-6,7-dimethoxy-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 2254069) has the molecular formula C27H31ClNO5+ and a molecular weight of 485.00 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-6,7-dimethoxy-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (1R)-1-(3-chlorophenyl)-6,7-dimethoxy-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 2254069 |
| Molecular Formula | C27H31ClNO5+ |
| Molecular Weight | 485.00 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-6,7-dimethoxy-2-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1cccc(Cl)c1)[NH+](Cc1cc(OC)c(OC)c(OC)c1)CC2 |
| InChI | InChI=1S/C27H30ClNO5/c1-30-22-14-18-9-10-29(16-17-11-24(32-3)27(34-5)25(12-17)33-4)26(21(18)15-23(22)31-2)19-7-6-8-20(28)13-19/h6-8,11-15,26H,9-10,16H2,1-5H3/p+1/t26-/m1/s1 |
| InChIKey | HYQRWCLPYGXIEP-AREMUKBSSA-O |
| XLogP | 4.11 |
| TPSA | 50.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.00 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |