About 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol
2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 22540705) has the molecular formula C18H25N5O2
and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| PubChem CID | 22540705 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | Cc1cc(C)cc(Oc2ncnc(N3CCN(CCO)CC3)c2N)c1 |
| InChI | InChI=1S/C18H25N5O2/c1-13-9-14(2)11-15(10-13)25-18-16(19)17(20-12-21-18)23-5-3-22(4-6-23)7-8-24/h9-12,24H,3-8,19H2,1-2H3 |
| InChIKey | OXZMXILQOVSZEA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol (CID 22540705) is 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol is Cc1cc(C)cc(Oc2ncnc(N3CCN(CCO)CC3)c2N)c1.
What is the InChIKey of 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol?
The InChIKey is OXZMXILQOVSZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O2/c1-13-9-14(2)11-15(10-13)25-18-16(19)17(20-12-21-18)23-5-3-22(4-6-23)7-8-24/h9-12,24H,3-8,19H2,1-2H3.
What are the key properties of 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol?
2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol has a molecular weight of 343.43 g/mol, XLogP of 1.58, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[5-amino-6-(3,5-dimethylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol is sourced from PubChem (CID 22540705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).