C26H21N3O3S2 — CID 2254262
(5Z)-3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 2254262) has the molecular formula C26H21N3O3S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (5Z)-3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2254262 |
| Molecular Formula | C26H21N3O3S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | (5Z)-3-benzyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylimino)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CN1/C(=C2/S/C(=N/c3ccc4c(c3)OCCO4)N(Cc3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C26H21N3O3S2/c1-28-19-9-5-6-10-22(19)33-25(28)23-24(30)29(16-17-7-3-2-4-8-17)26(34-23)27-18-11-12-20-21(15-18)32-14-13-31-20/h2-12,15H,13-14,16H2,1H3/b25-23-,27-26+ |
| InChIKey | LJMGAHLOWMEJEY-TZDKTLMISA-N |
| XLogP | 5.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|