About 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole
5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole (PubChem CID 2254327) has the molecular formula C22H15IN2O
and a molecular weight of 450.28 g/mol. Its IUPAC name is 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole.
Molecular Properties
| Compound Name | 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole |
| PubChem CID | 2254327 |
| Molecular Formula | C22H15IN2O |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole |
| SMILES | COc1ccc(-c2nc3c4cc(I)ccc4c4ccccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C22H15IN2O/c1-26-15-9-6-13(7-10-15)22-24-20-18-5-3-2-4-16(18)17-11-8-14(23)12-19(17)21(20)25-22/h2-12H,1H3,(H,24,25) |
| InChIKey | KOOFLHAQXBQARJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole?
The IUPAC name of 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole (CID 2254327) is 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole.
What is the SMILES notation for 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole?
The canonical SMILES for 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole is COc1ccc(-c2nc3c4cc(I)ccc4c4ccccc4c3[nH]2)cc1.
What is the InChIKey of 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole?
The InChIKey is KOOFLHAQXBQARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15IN2O/c1-26-15-9-6-13(7-10-15)22-24-20-18-5-3-2-4-16(18)17-11-8-14(23)12-19(17)21(20)25-22/h2-12H,1H3,(H,24,25).
What are the key properties of 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole?
5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole has a molecular weight of 450.28 g/mol, XLogP of 6.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-(4-methoxyphenyl)-1H-phenanthro[9,10-d]imidazole is sourced from PubChem (CID 2254327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).