C18H18BrN5 — CID 22544393
4-N-(3-bromophenyl)-6-N-(4-ethylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22544393) has the molecular formula C18H18BrN5 and a molecular weight of 384.28 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-6-N-(4-ethylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(3-bromophenyl)-6-N-(4-ethylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22544393 |
| Molecular Formula | C18H18BrN5 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 4-N-(3-bromophenyl)-6-N-(4-ethylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCc1ccc(Nc2ncnc(Nc3cccc(Br)c3)c2N)cc1 |
| InChI | InChI=1S/C18H18BrN5/c1-2-12-6-8-14(9-7-12)23-17-16(20)18(22-11-21-17)24-15-5-3-4-13(19)10-15/h3-11H,2,20H2,1H3,(H2,21,22,23,24) |
| InChIKey | BOVNSOOOHWABLH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |