C23H24Cl2N6 — CID 22544464
2-[4-[[5-amino-6-(butylamino)pyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile (PubChem CID 22544464) has the molecular formula C23H24Cl2N6 and a molecular weight of 455.39 g/mol. Its IUPAC name is 2-[4-[[5-amino-6-(butylamino)pyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-[4-[[5-amino-6-(butylamino)pyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 22544464 |
| Molecular Formula | C23H24Cl2N6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-[4-[[5-amino-6-(butylamino)pyrimidin-4-yl]amino]-2-chloro-5-methylphenyl]-2-(4-chlorophenyl)acetonitrile |
| SMILES | CCCCNc1ncnc(Nc2cc(Cl)c(C(C#N)c3ccc(Cl)cc3)cc2C)c1N |
| InChI | InChI=1S/C23H24Cl2N6/c1-3-4-9-28-22-21(27)23(30-13-29-22)31-20-11-19(25)17(10-14(20)2)18(12-26)15-5-7-16(24)8-6-15/h5-8,10-11,13,18H,3-4,9,27H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | KNDXFUDVZLVTLV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|