C17H23N5 — CID 22546979
4-N-(2,5-dimethylphenyl)-6-piperidin-1-ylpyrimidine-4,5-diamine (PubChem CID 22546979) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-6-piperidin-1-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-(2,5-dimethylphenyl)-6-piperidin-1-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22546979 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-6-piperidin-1-ylpyrimidine-4,5-diamine |
| SMILES | Cc1ccc(C)c(Nc2ncnc(N3CCCCC3)c2N)c1 |
| InChI | InChI=1S/C17H23N5/c1-12-6-7-13(2)14(10-12)21-16-15(18)17(20-11-19-16)22-8-4-3-5-9-22/h6-7,10-11H,3-5,8-9,18H2,1-2H3,(H,19,20,21) |
| InChIKey | JQSHQHMYSCNAPD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |