About ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate
ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate (PubChem CID 22548318) has the molecular formula C17H22N2O6S
and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate |
| PubChem CID | 22548318 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)c1cc2c(cc1C)NC(=O)CO2 |
| InChI | InChI=1S/C17H22N2O6S/c1-3-24-17(21)13-6-4-5-7-19(13)26(22,23)15-9-14-12(8-11(15)2)18-16(20)10-25-14/h8-9,13H,3-7,10H2,1-2H3,(H,18,20) |
| InChIKey | FVLSKGCAIDQAMJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate?
The IUPAC name of ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate (CID 22548318) is ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate.
What is the SMILES notation for ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate?
The canonical SMILES for ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate is CCOC(=O)C1CCCCN1S(=O)(=O)c1cc2c(cc1C)NC(=O)CO2.
What is the InChIKey of ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate?
The InChIKey is FVLSKGCAIDQAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O6S/c1-3-24-17(21)13-6-4-5-7-19(13)26(22,23)15-9-14-12(8-11(15)2)18-16(20)10-25-14/h8-9,13H,3-7,10H2,1-2H3,(H,18,20).
What are the key properties of ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate?
ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate has a molecular weight of 382.44 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(6-methyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl]piperidine-2-carboxylate is sourced from PubChem (CID 22548318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).