About 3-phenylpropyl N-phenylcarbamate
3-phenylpropyl N-phenylcarbamate (PubChem CID 2254838) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-phenylpropyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 3-phenylpropyl N-phenylcarbamate |
| PubChem CID | 2254838 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-phenylpropyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCCc1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c18-16(17-15-11-5-2-6-12-15)19-13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12H,7,10,13H2,(H,17,18) |
| InChIKey | OOKMUPQNYCIXMA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl N-phenylcarbamate?
The IUPAC name of 3-phenylpropyl N-phenylcarbamate (CID 2254838) is 3-phenylpropyl N-phenylcarbamate.
What is the SMILES notation for 3-phenylpropyl N-phenylcarbamate?
The canonical SMILES for 3-phenylpropyl N-phenylcarbamate is O=C(Nc1ccccc1)OCCCc1ccccc1.
What is the InChIKey of 3-phenylpropyl N-phenylcarbamate?
The InChIKey is OOKMUPQNYCIXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c18-16(17-15-11-5-2-6-12-15)19-13-7-10-14-8-3-1-4-9-14/h1-6,8-9,11-12H,7,10,13H2,(H,17,18).
What are the key properties of 3-phenylpropyl N-phenylcarbamate?
3-phenylpropyl N-phenylcarbamate has a molecular weight of 255.32 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl N-phenylcarbamate is sourced from PubChem (CID 2254838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).