C27H38N4O2S — CID 22549271
N-[3-(4-ethylpiperazin-1-yl)propyl]-2-(2-methylpropyl)-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 22549271) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-2-(2-methylpropyl)-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-(2-methylpropyl)-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22549271 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-2-(2-methylpropyl)-1-oxo-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)C2c3ccccc3C(=O)N(CC(C)C)C2c2cccs2)CC1 |
| InChI | InChI=1S/C27H38N4O2S/c1-4-29-14-16-30(17-15-29)13-8-12-28-26(32)24-21-9-5-6-10-22(21)27(33)31(19-20(2)3)25(24)23-11-7-18-34-23/h5-7,9-11,18,20,24-25H,4,8,12-17,19H2,1-3H3,(H,28,32) |
| InChIKey | VIEDRMIFGDKYAN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|