About 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one
1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one (PubChem CID 2254951) has the molecular formula C11H9N3O3
and a molecular weight of 231.21 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one |
| PubChem CID | 2254951 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one |
| SMILES | O=c1oc2ccccc2c2c1nnn2CCO |
| InChI | InChI=1S/C11H9N3O3/c15-6-5-14-10-7-3-1-2-4-8(7)17-11(16)9(10)12-13-14/h1-4,15H,5-6H2 |
| InChIKey | QZQOQRVWBXBSOT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one?
The IUPAC name of 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one (CID 2254951) is 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one.
What is the SMILES notation for 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one?
The canonical SMILES for 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one is O=c1oc2ccccc2c2c1nnn2CCO.
What is the InChIKey of 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one?
The InChIKey is QZQOQRVWBXBSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3/c15-6-5-14-10-7-3-1-2-4-8(7)17-11(16)9(10)12-13-14/h1-4,15H,5-6H2.
What are the key properties of 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one?
1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one has a molecular weight of 231.21 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)chromeno[3,4-d]triazol-4-one is sourced from PubChem (CID 2254951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).