C30H32N4O3 — CID 22549821
N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxamide (PubChem CID 22549821) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22549821 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3-methoxyphenyl)-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1cccc(-n2cc(C(=O)NCCN3CCN(Cc4ccccc4)CC3)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C30H32N4O3/c1-37-25-11-7-10-24(20-25)34-22-28(26-12-5-6-13-27(26)30(34)36)29(35)31-14-15-32-16-18-33(19-17-32)21-23-8-3-2-4-9-23/h2-13,20,22H,14-19,21H2,1H3,(H,31,35) |
| InChIKey | BOIOERMQILYDED-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |