C23H19N3O3 — CID 22549822
2-(3-methoxyphenyl)-N-(4-methyl-2-pyridinyl)-1-oxoisoquinoline-4-carboxamide (PubChem CID 22549822) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-(4-methyl-2-pyridinyl)-1-oxoisoquinoline-4-carboxamide.
| Compound Name | 2-(3-methoxyphenyl)-N-(4-methyl-2-pyridinyl)-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 22549822 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-(4-methyl-2-pyridinyl)-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1cccc(-n2cc(C(=O)Nc3cc(C)ccn3)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C23H19N3O3/c1-15-10-11-24-21(12-15)25-22(27)20-14-26(16-6-5-7-17(13-16)29-2)23(28)19-9-4-3-8-18(19)20/h3-14H,1-2H3,(H,24,25,27) |
| InChIKey | XCCKOZHRCPWNIT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |