C18H18N2O4S2 — CID 22549916
4-acetyl-N-(4-acetylphenyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonamide (PubChem CID 22549916) has the molecular formula C18H18N2O4S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-acetyl-N-(4-acetylphenyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 4-acetyl-N-(4-acetylphenyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 22549916 |
| Molecular Formula | C18H18N2O4S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-acetyl-N-(4-acetylphenyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonamide |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)N(C(C)=O)CCS3)cc1 |
| InChI | InChI=1S/C18H18N2O4S2/c1-12(21)14-3-5-15(6-4-14)19-26(23,24)16-7-8-18-17(11-16)20(13(2)22)9-10-25-18/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | KQARCEHJWWDDQP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |