About ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate
ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate (PubChem CID 22550005) has the molecular formula C16H20N2O5S2
and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate |
| PubChem CID | 22550005 |
| Molecular Formula | C16H20N2O5S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)CS3)CC1 |
| InChI | InChI=1S/C16H20N2O5S2/c1-2-23-16(20)11-5-7-18(8-6-11)25(21,22)12-3-4-14-13(9-12)17-15(19)10-24-14/h3-4,9,11H,2,5-8,10H2,1H3,(H,17,19) |
| InChIKey | XGHKWRXGFJUDOB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate (CID 22550005) is ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)CS3)CC1.
What is the InChIKey of ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate?
The InChIKey is XGHKWRXGFJUDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O5S2/c1-2-23-16(20)11-5-7-18(8-6-11)25(21,22)12-3-4-14-13(9-12)17-15(19)10-24-14/h3-4,9,11H,2,5-8,10H2,1H3,(H,17,19).
What are the key properties of ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate?
ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate has a molecular weight of 384.48 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(3-oxo-4H-1,4-benzothiazin-6-yl)sulfonyl]piperidine-4-carboxylate is sourced from PubChem (CID 22550005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).