C19H21N3O3 — CID 22550208
1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea (PubChem CID 22550208) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea.
| Compound Name | 1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 22550208 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-(4H-chromeno[3,4-d][1,2]oxazol-3-yl)-3-[2-(cyclohexen-1-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCCCC1)Nc1noc2c1COc1ccccc1-2 |
| InChI | InChI=1S/C19H21N3O3/c23-19(20-11-10-13-6-2-1-3-7-13)21-18-15-12-24-16-9-5-4-8-14(16)17(15)25-22-18/h4-6,8-9H,1-3,7,10-12H2,(H2,20,21,22,23) |
| InChIKey | WKHMRCXMTOVQPX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|