C20H19NO2 — CID 22550538
3-(2,4-dimethylanilino)-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 22550538) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(2,4-dimethylanilino)-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2,4-dimethylanilino)-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 22550538 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-(2,4-dimethylanilino)-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(Nc2c(-c3ccc(C)c(C)c3)c(=O)c2=O)c(C)c1 |
| InChI | InChI=1S/C20H19NO2/c1-11-5-8-16(14(4)9-11)21-18-17(19(22)20(18)23)15-7-6-12(2)13(3)10-15/h5-10,21H,1-4H3 |
| InChIKey | ZRDAMDDWDPSWCS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|