C19H22N2O3S — CID 22550784
4,6-dimethyl-N-phenyl-N-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 22550784) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 4,6-dimethyl-N-phenyl-N-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | 4,6-dimethyl-N-phenyl-N-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 22550784 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4,6-dimethyl-N-phenyl-N-prop-2-enyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cc2c(cc1C)N(C)CCO2 |
| InChI | InChI=1S/C19H22N2O3S/c1-4-10-21(16-8-6-5-7-9-16)25(22,23)19-14-18-17(13-15(19)2)20(3)11-12-24-18/h4-9,13-14H,1,10-12H2,2-3H3 |
| InChIKey | ZFKFSLIQQXKTOL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|