C17H13BrFN3S2 — CID 22552370
9-[(4-bromo-2-fluorophenyl)methylsulfanyl]-12-ethyl-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 22552370) has the molecular formula C17H13BrFN3S2 and a molecular weight of 422.35 g/mol. Its IUPAC name is 9-[(4-bromo-2-fluorophenyl)methylsulfanyl]-12-ethyl-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 9-[(4-bromo-2-fluorophenyl)methylsulfanyl]-12-ethyl-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 22552370 |
| Molecular Formula | C17H13BrFN3S2 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 9-[(4-bromo-2-fluorophenyl)methylsulfanyl]-12-ethyl-5-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CCc1nnc(SCc2ccc(Br)cc2F)c2cc3sccc3n12 |
| InChI | InChI=1S/C17H13BrFN3S2/c1-2-16-20-21-17(14-8-15-13(22(14)16)5-6-23-15)24-9-10-3-4-11(18)7-12(10)19/h3-8H,2,9H2,1H3 |
| InChIKey | JXTSRXWOOKUSSY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |