C12H11N3OS — CID 22552545
12-methyl-9-prop-2-enylsulfanyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 22552545) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 12-methyl-9-prop-2-enylsulfanyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-methyl-9-prop-2-enylsulfanyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 22552545 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 12-methyl-9-prop-2-enylsulfanyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | C=CCSc1nnc(C)n2c1cc1occc12 |
| InChI | InChI=1S/C12H11N3OS/c1-3-6-17-12-10-7-11-9(4-5-16-11)15(10)8(2)13-14-12/h3-5,7H,1,6H2,2H3 |
| InChIKey | ZVQTXHCKZXNXFA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|