C25H42N4O4S — CID 22552950
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1-[ethyl-(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide (PubChem CID 22552950) has the molecular formula C25H42N4O4S and a molecular weight of 494.70 g/mol. Its IUPAC name is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1-[ethyl-(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1-[ethyl-(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 22552950 |
| Molecular Formula | C25H42N4O4S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1-[ethyl-(4-methoxyphenyl)sulfamoyl]piperidine-3-carboxamide |
| SMILES | CCN(c1ccc(OC)cc1)S(=O)(=O)N1CCCC(C(=O)NCCCN2C(C)CCCC2C)C1 |
| InChI | InChI=1S/C25H42N4O4S/c1-5-29(23-12-14-24(33-4)15-13-23)34(31,32)27-17-7-11-22(19-27)25(30)26-16-8-18-28-20(2)9-6-10-21(28)3/h12-15,20-22H,5-11,16-19H2,1-4H3,(H,26,30) |
| InChIKey | AVXCSJVJMBQBBW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|