C22H29N5O2 — CID 22553436
N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide (PubChem CID 22553436) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide |
|---|---|
| PubChem CID | 22553436 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-2-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide |
| SMILES | CCC1CCCCN1CCCNC(=O)Cn1c(=O)c2cccn2c2cccnc21 |
| InChI | InChI=1S/C22H29N5O2/c1-2-17-8-3-4-13-25(17)14-7-12-23-20(28)16-27-21-18(9-5-11-24-21)26-15-6-10-19(26)22(27)29/h5-6,9-11,15,17H,2-4,7-8,12-14,16H2,1H3,(H,23,28) |
| InChIKey | AGAOHRQIMHTUMX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|