C23H22N4O4 — CID 22553519
ethyl 3-[4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanoylamino]benzoate (PubChem CID 22553519) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl 3-[4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanoylamino]benzoate.
| Compound Name | ethyl 3-[4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 22553519 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 3-[4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CCCn2c(=O)c3cccn3c3cccnc32)c1 |
| InChI | InChI=1S/C23H22N4O4/c1-2-31-23(30)16-7-3-8-17(15-16)25-20(28)11-6-14-27-21-18(9-4-12-24-21)26-13-5-10-19(26)22(27)29/h3-5,7-10,12-13,15H,2,6,11,14H2,1H3,(H,25,28) |
| InChIKey | FOSOMEHDSVPEGA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |