C21H20N4O2S — CID 22553541
N-(3-methylsulfanylphenyl)-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanamide (PubChem CID 22553541) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanamide.
| Compound Name | N-(3-methylsulfanylphenyl)-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanamide |
|---|---|
| PubChem CID | 22553541 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-4-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)butanamide |
| SMILES | CSc1cccc(NC(=O)CCCn2c(=O)c3cccn3c3cccnc32)c1 |
| InChI | InChI=1S/C21H20N4O2S/c1-28-16-7-2-6-15(14-16)23-19(26)10-5-13-25-20-17(8-3-11-22-20)24-12-4-9-18(24)21(25)27/h2-4,6-9,11-12,14H,5,10,13H2,1H3,(H,23,26) |
| InChIKey | BXTYSAHAUFQCEP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |