C24H27N3O2 — CID 22553681
N-benzyl-N-ethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide (PubChem CID 22553681) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide.
| Compound Name | N-benzyl-N-ethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
|---|---|
| PubChem CID | 22553681 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-benzyl-N-ethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CC2CCCN2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H27N3O2/c1-2-26(16-17-9-4-3-5-10-17)22(28)20-15-18-11-8-14-27(18)24(20)19-12-6-7-13-21(19)25-23(24)29/h3-7,9-10,12-13,18,20H,2,8,11,14-16H2,1H3,(H,25,29) |
| InChIKey | UPUDLEFGJUKYTF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |