C25H36N4O2 — CID 22553731
N-[3-[cyclohexyl(methyl)amino]propyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide (PubChem CID 22553731) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
|---|---|
| PubChem CID | 22553731 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carboxamide |
| SMILES | CN(CCCNC(=O)C1CC2CCCN2C12C(=O)Nc1ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C25H36N4O2/c1-28(18-9-3-2-4-10-18)15-8-14-26-23(30)21-17-19-11-7-16-29(19)25(21)20-12-5-6-13-22(20)27-24(25)31/h5-6,12-13,18-19,21H,2-4,7-11,14-17H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | GVLNPAGCGYPTQL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|