C24H25N3O3 — CID 22553744
N-(4-acetylphenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide (PubChem CID 22553744) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
|---|---|
| PubChem CID | 22553744 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-(4-acetylphenyl)-1'-methyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-indole]-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C2CC3CCCN3C23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-15(28)16-9-11-17(12-10-16)25-22(29)20-14-18-6-5-13-27(18)24(20)19-7-3-4-8-21(19)26(2)23(24)30/h3-4,7-12,18,20H,5-6,13-14H2,1-2H3,(H,25,29) |
| InChIKey | DRDWZWPEMFPULX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |