C23H25N2S+ — CID 2255545
3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium (PubChem CID 2255545) has the molecular formula C23H25N2S+ and a molecular weight of 361.53 g/mol. Its IUPAC name is 3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 2255545 |
| Molecular Formula | C23H25N2S+ |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C/C=C2/N(C)c3ccccc3C2(C)C)sc2ccccc21 |
| InChI | InChI=1S/C23H25N2S/c1-5-25-19-13-8-9-14-20(19)26-22(25)16-10-15-21-23(2,3)17-11-6-7-12-18(17)24(21)4/h6-16H,5H2,1-4H3/q+1 |
| InChIKey | NIAOXEKTWMHVEO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|