About 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene
1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 22555633) has the molecular formula C16H20O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene.
Molecular Properties
| Compound Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene |
| PubChem CID | 22555633 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | CC(C)(C)Oc1ccccc1CC1=CCC=C1 |
| InChI | InChI=1S/C16H20O/c1-16(2,3)17-15-11-7-6-10-14(15)12-13-8-4-5-9-13/h4,6-11H,5,12H2,1-3H3 |
| InChIKey | HXPJHUYTWPAAAH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene?
The IUPAC name of 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene (CID 22555633) is 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene.
What is the SMILES notation for 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene?
The canonical SMILES for 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene is CC(C)(C)Oc1ccccc1CC1=CCC=C1.
What is the InChIKey of 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene?
The InChIKey is HXPJHUYTWPAAAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O/c1-16(2,3)17-15-11-7-6-10-14(15)12-13-8-4-5-9-13/h4,6-11H,5,12H2,1-3H3.
What are the key properties of 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene?
1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene has a molecular weight of 228.34 g/mol, XLogP of 4.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopenta-1,4-dien-1-ylmethyl)-2-[(2-methylpropan-2-yl)oxy]benzene is sourced from PubChem (CID 22555633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).