C22H36OSi — CID 22555725
cyclopenta-1,4-dien-1-yl-(2,4-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-dimethylsilane (PubChem CID 22555725) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-yl-(2,4-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | cyclopenta-1,4-dien-1-yl-(2,4-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 22555725 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | cyclopenta-1,4-dien-1-yl-(2,4-ditert-butyl-1-methoxycyclohexa-2,4-dien-1-yl)-dimethylsilane |
| SMILES | COC1([Si](C)(C)C2=CCC=C2)CC=C(C(C)(C)C)C=C1C(C)(C)C |
| InChI | InChI=1S/C22H36OSi/c1-20(2,3)17-14-15-22(23-7,19(16-17)21(4,5)6)24(8,9)18-12-10-11-13-18/h10,12-14,16H,11,15H2,1-9H3 |
| InChIKey | UWDSVFIBHBBKHE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|