About 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid
2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (PubChem CID 22556510) has the molecular formula C7H4BrNO2S
and a molecular weight of 246.09 g/mol. Its IUPAC name is 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
| PubChem CID | 22556510 |
| Molecular Formula | C7H4BrNO2S |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 244.91 |
| IUPAC Name | 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Br)sc2[nH]1 |
| InChI | InChI=1S/C7H4BrNO2S/c8-5-2-3-1-4(7(10)11)9-6(3)12-5/h1-2,9H,(H,10,11) |
| InChIKey | XAFRVVYPVBHBMA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid?
The IUPAC name of 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid (CID 22556510) is 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is O=C(O)c1cc2cc(Br)sc2[nH]1.
What is the InChIKey of 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid?
The InChIKey is XAFRVVYPVBHBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNO2S/c8-5-2-3-1-4(7(10)11)9-6(3)12-5/h1-2,9H,(H,10,11).
What are the key properties of 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid?
2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid has a molecular weight of 246.09 g/mol, XLogP of 2.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 22556510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).