C24H19N3O3 — CID 22556672
3-(1H-indol-3-yl)-4-(6-methoxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrrole-2,5-dione (PubChem CID 22556672) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-(6-methoxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-4-(6-methoxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22556672 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-(6-methoxy-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)pyrrole-2,5-dione |
| SMILES | COc1cc2c3c(c1)c(C1=C(c4c[nH]c5ccccc45)C(=O)NC1=O)cn3CCC2 |
| InChI | InChI=1S/C24H19N3O3/c1-30-14-9-13-5-4-8-27-12-18(16(10-14)22(13)27)21-20(23(28)26-24(21)29)17-11-25-19-7-3-2-6-15(17)19/h2-3,6-7,9-12,25H,4-5,8H2,1H3,(H,26,28,29) |
| InChIKey | RFLLJUBERQGNEK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|