C25H19N3O4 — CID 22556734
methyl 3-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,5-dioxopyrrol-3-yl]-1H-indole-5-carboxylate (PubChem CID 22556734) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 3-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,5-dioxopyrrol-3-yl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,5-dioxopyrrol-3-yl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 22556734 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | methyl 3-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,5-dioxopyrrol-3-yl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(C3=C(c4cn5c6c(cccc46)CCC5)C(=O)NC3=O)c2c1 |
| InChI | InChI=1S/C25H19N3O4/c1-32-25(31)14-7-8-19-16(10-14)17(11-26-19)20-21(24(30)27-23(20)29)18-12-28-9-3-5-13-4-2-6-15(18)22(13)28/h2,4,6-8,10-12,26H,3,5,9H2,1H3,(H,27,29,30) |
| InChIKey | CKDVMBRHSMQUKO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|